5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid

C11H8BrNO3 — CID 53406934

IUPAC5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid
SMILESCc1c(C(=O)O)noc1-c1ccc(Br)cc1
InChIInChI=1S/C11H8BrNO3/c1-6-9(11(14)15)13-16-10(6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15)
InChIKeyYHBXXLCJEYNPFH-UHFFFAOYSA-N
MW282.09 g/mol
LogP3.11
Rot. Bonds2

About 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid

5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid (PubChem CID 53406934) has the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid
PubChem CID53406934
Molecular FormulaC11H8BrNO3
Molecular Weight282.09 g/mol
Exact Mass280.97
IUPAC Name5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid
SMILESCc1c(C(=O)O)noc1-c1ccc(Br)cc1
InChIInChI=1S/C11H8BrNO3/c1-6-9(11(14)15)13-16-10(6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15)
InChIKeyYHBXXLCJEYNPFH-UHFFFAOYSA-N
XLogP3.11
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.09
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid (CID 53406934) is 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid is Cc1c(C(=O)O)noc1-c1ccc(Br)cc1.
What is the InChIKey of 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid?
The InChIKey is YHBXXLCJEYNPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO3/c1-6-9(11(14)15)13-16-10(6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15).
What are the key properties of 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid?
5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid has a molecular weight of 282.09 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-4-methyl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 53406934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).