C12H18N2 — CID 53407083
1,4,4-trimethyl-2,3-dihydroquinolin-6-amine (PubChem CID 53407083) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,4,4-trimethyl-2,3-dihydroquinolin-6-amine.
| Compound Name | 1,4,4-trimethyl-2,3-dihydroquinolin-6-amine |
|---|---|
| PubChem CID | 53407083 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1,4,4-trimethyl-2,3-dihydroquinolin-6-amine |
| SMILES | CN1CCC(C)(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C12H18N2/c1-12(2)6-7-14(3)11-5-4-9(13)8-10(11)12/h4-5,8H,6-7,13H2,1-3H3 |
| InChIKey | BWEJCNRADFZAKH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|