C29H31NO2 — CID 5340752
(E)-3-(4-methoxyphenyl)-1-[2,2,4-trimethyl-4-(4-methylphenyl)-3H-quinolin-1-yl]prop-2-en-1-one (PubChem CID 5340752) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-[2,2,4-trimethyl-4-(4-methylphenyl)-3H-quinolin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-[2,2,4-trimethyl-4-(4-methylphenyl)-3H-quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 5340752 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-[2,2,4-trimethyl-4-(4-methylphenyl)-3H-quinolin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2c3ccccc3C(C)(c3ccc(C)cc3)CC2(C)C)cc1 |
| InChI | InChI=1S/C29H31NO2/c1-21-10-15-23(16-11-21)29(4)20-28(2,3)30(26-9-7-6-8-25(26)29)27(31)19-14-22-12-17-24(32-5)18-13-22/h6-19H,20H2,1-5H3/b19-14+ |
| InChIKey | NRTDZUHMCHARHE-XMHGGMMESA-N |
| XLogP | 6.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|