C14H15NO — CID 53407688
3-(2,6-dimethylanilino)phenol (PubChem CID 53407688) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(2,6-dimethylanilino)phenol.
| Compound Name | 3-(2,6-dimethylanilino)phenol |
|---|---|
| PubChem CID | 53407688 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(2,6-dimethylanilino)phenol |
| SMILES | Cc1cccc(C)c1Nc1cccc(O)c1 |
| InChI | InChI=1S/C14H15NO/c1-10-5-3-6-11(2)14(10)15-12-7-4-8-13(16)9-12/h3-9,15-16H,1-2H3 |
| InChIKey | ZQHONSDEIKIIGH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |