About 3-(4-bromophenyl)pyrrolidine;hydrochloride
3-(4-bromophenyl)pyrrolidine;hydrochloride (PubChem CID 53407708) has the molecular formula C10H13BrClN
and a molecular weight of 262.58 g/mol. Its IUPAC name is 3-(4-bromophenyl)pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)pyrrolidine;hydrochloride |
| PubChem CID | 53407708 |
| Molecular Formula | C10H13BrClN |
| Molecular Weight | 262.58 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 3-(4-bromophenyl)pyrrolidine;hydrochloride |
| SMILES | Brc1ccc(C2CCNC2)cc1.Cl |
| InChI | InChI=1S/C10H12BrN.ClH/c11-10-3-1-8(2-4-10)9-5-6-12-7-9;/h1-4,9,12H,5-7H2;1H |
| InChIKey | ILDBWPNFCRWOGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-bromophenyl)pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)pyrrolidine;hydrochloride?
The IUPAC name of 3-(4-bromophenyl)pyrrolidine;hydrochloride (CID 53407708) is 3-(4-bromophenyl)pyrrolidine;hydrochloride.
What is the SMILES notation for 3-(4-bromophenyl)pyrrolidine;hydrochloride?
The canonical SMILES for 3-(4-bromophenyl)pyrrolidine;hydrochloride is Brc1ccc(C2CCNC2)cc1.Cl.
What is the InChIKey of 3-(4-bromophenyl)pyrrolidine;hydrochloride?
The InChIKey is ILDBWPNFCRWOGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN.ClH/c11-10-3-1-8(2-4-10)9-5-6-12-7-9;/h1-4,9,12H,5-7H2;1H.
What are the key properties of 3-(4-bromophenyl)pyrrolidine;hydrochloride?
3-(4-bromophenyl)pyrrolidine;hydrochloride has a molecular weight of 262.58 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)pyrrolidine;hydrochloride is sourced from PubChem (CID 53407708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).