About 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride
4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride (PubChem CID 53407813) has the molecular formula C5H8ClF6N
and a molecular weight of 231.57 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride |
| PubChem CID | 53407813 |
| Molecular Formula | C5H8ClF6N |
| Molecular Weight | 231.57 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride |
| SMILES | Cl.NCCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6N.ClH/c6-4(7,8)3(1-2-12)5(9,10)11;/h3H,1-2,12H2;1H |
| InChIKey | DRUKMCKOYBHFLT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride?
The IUPAC name of 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride (CID 53407813) is 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride.
What is the SMILES notation for 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride?
The canonical SMILES for 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride is Cl.NCCC(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride?
The InChIKey is DRUKMCKOYBHFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F6N.ClH/c6-4(7,8)3(1-2-12)5(9,10)11;/h3H,1-2,12H2;1H.
What are the key properties of 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride?
4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride has a molecular weight of 231.57 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluoro-3-(trifluoromethyl)butan-1-amine;hydrochloride is sourced from PubChem (CID 53407813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).