About 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride
1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride (PubChem CID 53407976) has the molecular formula C12H18Cl2N2
and a molecular weight of 261.20 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride.
Molecular Properties
| Compound Name | 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride |
| PubChem CID | 53407976 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)CCN2C1CCNC1 |
| InChI | InChI=1S/C12H16N2.2ClH/c1-2-4-12-10(3-1)6-8-14(12)11-5-7-13-9-11;;/h1-4,11,13H,5-9H2;2*1H |
| InChIKey | IISPGFJCBJMNHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride?
The IUPAC name of 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride (CID 53407976) is 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride.
What is the SMILES notation for 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride?
The canonical SMILES for 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride is Cl.Cl.c1ccc2c(c1)CCN2C1CCNC1.
What is the InChIKey of 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride?
The InChIKey is IISPGFJCBJMNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.2ClH/c1-2-4-12-10(3-1)6-8-14(12)11-5-7-13-9-11;;/h1-4,11,13H,5-9H2;2*1H.
What are the key properties of 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride?
1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride has a molecular weight of 261.20 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-3-yl-2,3-dihydroindole;dihydrochloride is sourced from PubChem (CID 53407976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).