About 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol (PubChem CID 53407989) has the molecular formula C8H12ClN5O
and a molecular weight of 229.67 g/mol. Its IUPAC name is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol |
| PubChem CID | 53407989 |
| Molecular Formula | C8H12ClN5O |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol |
| SMILES | Nc1nc(Cl)nc(N2CCC(O)CC2)n1 |
| InChI | InChI=1S/C8H12ClN5O/c9-6-11-7(10)13-8(12-6)14-3-1-5(15)2-4-14/h5,15H,1-4H2,(H2,10,11,12,13) |
| InChIKey | MQFWNYSJYNARGV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol?
The IUPAC name of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol (CID 53407989) is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol.
What is the SMILES notation for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol?
The canonical SMILES for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol is Nc1nc(Cl)nc(N2CCC(O)CC2)n1.
What is the InChIKey of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol?
The InChIKey is MQFWNYSJYNARGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN5O/c9-6-11-7(10)13-8(12-6)14-3-1-5(15)2-4-14/h5,15H,1-4H2,(H2,10,11,12,13).
What are the key properties of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol?
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol has a molecular weight of 229.67 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperidin-4-ol is sourced from PubChem (CID 53407989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).