About 5,6-difluoro-1,3-dihydroinden-2-one
5,6-difluoro-1,3-dihydroinden-2-one (PubChem CID 53408037) has the molecular formula C9H6F2O
and a molecular weight of 168.14 g/mol. Its IUPAC name is 5,6-difluoro-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | 5,6-difluoro-1,3-dihydroinden-2-one |
| PubChem CID | 53408037 |
| Molecular Formula | C9H6F2O |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5,6-difluoro-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2cc(F)c(F)cc2C1 |
| InChI | InChI=1S/C9H6F2O/c10-8-3-5-1-7(12)2-6(5)4-9(8)11/h3-4H,1-2H2 |
| InChIKey | FPOCXYWEBBMGFD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-difluoro-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-1,3-dihydroinden-2-one?
The IUPAC name of 5,6-difluoro-1,3-dihydroinden-2-one (CID 53408037) is 5,6-difluoro-1,3-dihydroinden-2-one.
What is the SMILES notation for 5,6-difluoro-1,3-dihydroinden-2-one?
The canonical SMILES for 5,6-difluoro-1,3-dihydroinden-2-one is O=C1Cc2cc(F)c(F)cc2C1.
What is the InChIKey of 5,6-difluoro-1,3-dihydroinden-2-one?
The InChIKey is FPOCXYWEBBMGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2O/c10-8-3-5-1-7(12)2-6(5)4-9(8)11/h3-4H,1-2H2.
What are the key properties of 5,6-difluoro-1,3-dihydroinden-2-one?
5,6-difluoro-1,3-dihydroinden-2-one has a molecular weight of 168.14 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-1,3-dihydroinden-2-one is sourced from PubChem (CID 53408037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).