About 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride
5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (PubChem CID 53408104) has the molecular formula C8H9BrClNO
and a molecular weight of 250.52 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| PubChem CID | 53408104 |
| Molecular Formula | C8H9BrClNO |
| Molecular Weight | 250.52 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| SMILES | Cl.NC1COc2ccc(Br)cc21 |
| InChI | InChI=1S/C8H8BrNO.ClH/c9-5-1-2-8-6(3-5)7(10)4-11-8;/h1-3,7H,4,10H2;1H |
| InChIKey | UKCIFENUZLYBRF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The IUPAC name of 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CID 53408104) is 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride.
What is the SMILES notation for 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The canonical SMILES for 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride is Cl.NC1COc2ccc(Br)cc21.
What is the InChIKey of 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
The InChIKey is UKCIFENUZLYBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO.ClH/c9-5-1-2-8-6(3-5)7(10)4-11-8;/h1-3,7H,4,10H2;1H.
What are the key properties of 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride?
5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride has a molecular weight of 250.52 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride is sourced from PubChem (CID 53408104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).