About tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate
tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 53408420) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 53408420 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2cc(C=O)ccc21 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,3)19-14(18)16-8-4-5-12-9-11(10-17)6-7-13(12)16/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | UDIUSIJWIQNTJJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate (CID 53408420) is tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate is CC(C)(C)OC(=O)N1CCCc2cc(C=O)ccc21.
What is the InChIKey of tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is UDIUSIJWIQNTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-15(2,3)19-14(18)16-8-4-5-12-9-11(10-17)6-7-13(12)16/h6-7,9-10H,4-5,8H2,1-3H3.
What are the key properties of tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate?
tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 261.32 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-formyl-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 53408420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).