About 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline
8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline (PubChem CID 53408516) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| PubChem CID | 53408516 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| SMILES | CC1(C)CCNc2c(Cl)cccc21 |
| InChI | InChI=1S/C11H14ClN/c1-11(2)6-7-13-10-8(11)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | HTAZLKVIDBIQSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline?
The IUPAC name of 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline (CID 53408516) is 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline.
What is the SMILES notation for 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline?
The canonical SMILES for 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline is CC1(C)CCNc2c(Cl)cccc21.
What is the InChIKey of 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline?
The InChIKey is HTAZLKVIDBIQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN/c1-11(2)6-7-13-10-8(11)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3.
What are the key properties of 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline?
8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline has a molecular weight of 195.69 g/mol, XLogP of 3.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4,4-dimethyl-2,3-dihydro-1H-quinoline is sourced from PubChem (CID 53408516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).