About isoquinolin-8-yl trifluoromethanesulfonate
isoquinolin-8-yl trifluoromethanesulfonate (PubChem CID 53408698) has the molecular formula C10H6F3NO3S
and a molecular weight of 277.22 g/mol. Its IUPAC name is isoquinolin-8-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | isoquinolin-8-yl trifluoromethanesulfonate |
| PubChem CID | 53408698 |
| Molecular Formula | C10H6F3NO3S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | isoquinolin-8-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc2ccncc12)C(F)(F)F |
| InChI | InChI=1S/C10H6F3NO3S/c11-10(12,13)18(15,16)17-9-3-1-2-7-4-5-14-6-8(7)9/h1-6H |
| InChIKey | MWALAZWDGYMEJY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze isoquinolin-8-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-8-yl trifluoromethanesulfonate?
The IUPAC name of isoquinolin-8-yl trifluoromethanesulfonate (CID 53408698) is isoquinolin-8-yl trifluoromethanesulfonate.
What is the SMILES notation for isoquinolin-8-yl trifluoromethanesulfonate?
The canonical SMILES for isoquinolin-8-yl trifluoromethanesulfonate is O=S(=O)(Oc1cccc2ccncc12)C(F)(F)F.
What is the InChIKey of isoquinolin-8-yl trifluoromethanesulfonate?
The InChIKey is MWALAZWDGYMEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NO3S/c11-10(12,13)18(15,16)17-9-3-1-2-7-4-5-14-6-8(7)9/h1-6H.
What are the key properties of isoquinolin-8-yl trifluoromethanesulfonate?
isoquinolin-8-yl trifluoromethanesulfonate has a molecular weight of 277.22 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-8-yl trifluoromethanesulfonate is sourced from PubChem (CID 53408698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).