C10H11Br2NO — CID 53409181
3-(2,4-dibromophenoxy)pyrrolidine (PubChem CID 53409181) has the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. Its IUPAC name is 3-(2,4-dibromophenoxy)pyrrolidine.
| Compound Name | 3-(2,4-dibromophenoxy)pyrrolidine |
|---|---|
| PubChem CID | 53409181 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 3-(2,4-dibromophenoxy)pyrrolidine |
| SMILES | Brc1ccc(OC2CCNC2)c(Br)c1 |
| InChI | InChI=1S/C10H11Br2NO/c11-7-1-2-10(9(12)5-7)14-8-3-4-13-6-8/h1-2,5,8,13H,3-4,6H2 |
| InChIKey | VLVCUKPCHYAILC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |