About 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride
4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride (PubChem CID 53409861) has the molecular formula C11H13Cl4NO
and a molecular weight of 317.04 g/mol. Its IUPAC name is 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride |
| PubChem CID | 53409861 |
| Molecular Formula | C11H13Cl4NO |
| Molecular Weight | 317.04 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride |
| SMILES | Cl.Clc1cc(Cl)c(OC2CCNCC2)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO.ClH/c12-8-5-10(14)11(6-9(8)13)16-7-1-3-15-4-2-7;/h5-7,15H,1-4H2;1H |
| InChIKey | FNVHYFWGOROEGO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride?
The IUPAC name of 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride (CID 53409861) is 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride.
What is the SMILES notation for 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride?
The canonical SMILES for 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride is Cl.Clc1cc(Cl)c(OC2CCNCC2)cc1Cl.
What is the InChIKey of 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride?
The InChIKey is FNVHYFWGOROEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl3NO.ClH/c12-8-5-10(14)11(6-9(8)13)16-7-1-3-15-4-2-7;/h5-7,15H,1-4H2;1H.
What are the key properties of 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride?
4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride has a molecular weight of 317.04 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4,5-trichlorophenoxy)piperidine;hydrochloride is sourced from PubChem (CID 53409861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).