About 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one
4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one (PubChem CID 53409902) has the molecular formula C7H9ClN6O
and a molecular weight of 228.64 g/mol. Its IUPAC name is 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one |
| PubChem CID | 53409902 |
| Molecular Formula | C7H9ClN6O |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one |
| SMILES | Nc1nc(Cl)nc(N2CCNC(=O)C2)n1 |
| InChI | InChI=1S/C7H9ClN6O/c8-5-11-6(9)13-7(12-5)14-2-1-10-4(15)3-14/h1-3H2,(H,10,15)(H2,9,11,12,13) |
| InChIKey | XEVKEQDVMRJDQG-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one?
The IUPAC name of 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one (CID 53409902) is 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one.
What is the SMILES notation for 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one?
The canonical SMILES for 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one is Nc1nc(Cl)nc(N2CCNC(=O)C2)n1.
What is the InChIKey of 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one?
The InChIKey is XEVKEQDVMRJDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN6O/c8-5-11-6(9)13-7(12-5)14-2-1-10-4(15)3-14/h1-3H2,(H,10,15)(H2,9,11,12,13).
What are the key properties of 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one?
4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one has a molecular weight of 228.64 g/mol, XLogP of -0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazin-2-one is sourced from PubChem (CID 53409902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).