About rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol
rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol (PubChem CID 53410317) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is [4-(hydroxymethyl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol |
| PubChem CID | 53410317 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | [4-(hydroxymethyl)pyrrolidin-3-yl]methanol |
| SMILES | C1C(C(CN1)CO)CO |
| InChI | InChI=1S/C6H13NO2/c8-3-5-1-7-2-6(5)4-9/h5-9H,1-4H2 |
| InChIKey | ZRERAZQFEFFXSJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 52.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | 77 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol?
The IUPAC name of rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol (CID 53410317) is [4-(hydroxymethyl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol?
The canonical SMILES for rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol is C1C(C(CN1)CO)CO.
What is the InChIKey of rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol?
The InChIKey is ZRERAZQFEFFXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c8-3-5-1-7-2-6(5)4-9/h5-9H,1-4H2.
What are the key properties of rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol?
rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol has a molecular weight of 131.17 g/mol, XLogP of -1.30, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for rac-[(3S,4R)-4-(hydroxymethyl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 53410317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).