C11H18ClN5 — CID 53410711
6-chloro-2-N-cyclohexyl-2-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 53410711) has the molecular formula C11H18ClN5 and a molecular weight of 255.75 g/mol. Its IUPAC name is 6-chloro-2-N-cyclohexyl-2-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-cyclohexyl-2-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 53410711 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 6-chloro-2-N-cyclohexyl-2-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(c1nc(N)nc(Cl)n1)C1CCCCC1 |
| InChI | InChI=1S/C11H18ClN5/c1-2-17(8-6-4-3-5-7-8)11-15-9(12)14-10(13)16-11/h8H,2-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | MMNDZFUUJHNLBL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |