About urea;hydrobromide
urea;hydrobromide (PubChem CID 53411231) has the molecular formula CH5BrN2O
and a molecular weight of 140.97 g/mol. Its IUPAC name is urea;hydrobromide.
Molecular Properties
| Compound Name | urea;hydrobromide |
| PubChem CID | 53411231 |
| Molecular Formula | CH5BrN2O |
| Molecular Weight | 140.97 g/mol |
| Exact Mass | 139.96 |
| IUPAC Name | urea;hydrobromide |
| SMILES | Br.NC(N)=O |
| InChI | InChI=1S/CH4N2O.BrH/c2-1(3)4;/h(H4,2,3,4);1H |
| InChIKey | DXXBBUOVGDAFFJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.97 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze urea;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of urea;hydrobromide?
The IUPAC name of urea;hydrobromide (CID 53411231) is urea;hydrobromide.
What is the SMILES notation for urea;hydrobromide?
The canonical SMILES for urea;hydrobromide is Br.NC(N)=O.
What is the InChIKey of urea;hydrobromide?
The InChIKey is DXXBBUOVGDAFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.BrH/c2-1(3)4;/h(H4,2,3,4);1H.
What are the key properties of urea;hydrobromide?
urea;hydrobromide has a molecular weight of 140.97 g/mol, XLogP of -0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for urea;hydrobromide is sourced from PubChem (CID 53411231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).