About 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate
3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate (PubChem CID 53411745) has the molecular formula C9H9NO4-2
and a molecular weight of 195.17 g/mol. Its IUPAC name is 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate |
| PubChem CID | 53411745 |
| Molecular Formula | C9H9NO4-2 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate |
| SMILES | CC1(C(=O)[O-])C=CC(C(=O)[O-])=CC1N |
| InChI | InChI=1S/C9H11NO4/c1-9(8(13)14)3-2-5(7(11)12)4-6(9)10/h2-4,6H,10H2,1H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | BJDIRCMGQJMEKR-UHFFFAOYSA-L |
| XLogP | -2.68 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate?
The IUPAC name of 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate (CID 53411745) is 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate.
What is the SMILES notation for 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate?
The canonical SMILES for 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate is CC1(C(=O)[O-])C=CC(C(=O)[O-])=CC1N.
What is the InChIKey of 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate?
The InChIKey is BJDIRCMGQJMEKR-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H11NO4/c1-9(8(13)14)3-2-5(7(11)12)4-6(9)10/h2-4,6H,10H2,1H3,(H,11,12)(H,13,14)/p-2.
What are the key properties of 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate?
3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate has a molecular weight of 195.17 g/mol, XLogP of -2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methylcyclohexa-1,5-diene-1,4-dicarboxylate is sourced from PubChem (CID 53411745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).