About 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one
3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 53412537) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 53412537 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | Nc1c[nH]c2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C7H7N3O/c8-5-3-10-6-4(5)1-2-9-7(6)11/h1-3,10H,8H2,(H,9,11) |
| InChIKey | ZWYGSPRXFKMCIF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (CID 53412537) is 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is Nc1c[nH]c2c(=O)[nH]ccc12.
What is the InChIKey of 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The InChIKey is ZWYGSPRXFKMCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-5-3-10-6-4(5)1-2-9-7(6)11/h1-3,10H,8H2,(H,9,11).
What are the key properties of 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one has a molecular weight of 149.15 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 53412537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).