C8H4N4O2 — CID 53412740
3-nitro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile (PubChem CID 53412740) has the molecular formula C8H4N4O2 and a molecular weight of 188.15 g/mol. Its IUPAC name is 3-nitro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile.
| Compound Name | 3-nitro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 53412740 |
| Molecular Formula | C8H4N4O2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 3-nitro-1H-pyrrolo[2,3-c]pyridine-7-carbonitrile |
| SMILES | N#Cc1nccc2c([N+](=O)[O-])c[nH]c12 |
| InChI | InChI=1S/C8H4N4O2/c9-3-6-8-5(1-2-10-6)7(4-11-8)12(13)14/h1-2,4,11H |
| InChIKey | JHPVRRNCEVJOMY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|