About 2-chloro-6-methoxy-1,3-benzothiazol-4-amine
2-chloro-6-methoxy-1,3-benzothiazol-4-amine (PubChem CID 53412789) has the molecular formula C8H7ClN2OS
and a molecular weight of 214.68 g/mol. Its IUPAC name is 2-chloro-6-methoxy-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-6-methoxy-1,3-benzothiazol-4-amine |
| PubChem CID | 53412789 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-chloro-6-methoxy-1,3-benzothiazol-4-amine |
| SMILES | COc1cc(N)c2nc(Cl)sc2c1 |
| InChI | InChI=1S/C8H7ClN2OS/c1-12-4-2-5(10)7-6(3-4)13-8(9)11-7/h2-3H,10H2,1H3 |
| InChIKey | VELJDZAZIMKLGM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methoxy-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methoxy-1,3-benzothiazol-4-amine?
The IUPAC name of 2-chloro-6-methoxy-1,3-benzothiazol-4-amine (CID 53412789) is 2-chloro-6-methoxy-1,3-benzothiazol-4-amine.
What is the SMILES notation for 2-chloro-6-methoxy-1,3-benzothiazol-4-amine?
The canonical SMILES for 2-chloro-6-methoxy-1,3-benzothiazol-4-amine is COc1cc(N)c2nc(Cl)sc2c1.
What is the InChIKey of 2-chloro-6-methoxy-1,3-benzothiazol-4-amine?
The InChIKey is VELJDZAZIMKLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2OS/c1-12-4-2-5(10)7-6(3-4)13-8(9)11-7/h2-3H,10H2,1H3.
What are the key properties of 2-chloro-6-methoxy-1,3-benzothiazol-4-amine?
2-chloro-6-methoxy-1,3-benzothiazol-4-amine has a molecular weight of 214.68 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methoxy-1,3-benzothiazol-4-amine is sourced from PubChem (CID 53412789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).