About 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one
4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one (PubChem CID 53412864) has the molecular formula C7H5FN2O
and a molecular weight of 152.13 g/mol. Its IUPAC name is 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one |
| PubChem CID | 53412864 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one |
| SMILES | O=c1cc(F)c2cc[nH]c2[nH]1 |
| InChI | InChI=1S/C7H5FN2O/c8-5-3-6(11)10-7-4(5)1-2-9-7/h1-3H,(H2,9,10,11) |
| InChIKey | VXEXHLJTFTXCAP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one?
The IUPAC name of 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one (CID 53412864) is 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one.
What is the SMILES notation for 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one?
The canonical SMILES for 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one is O=c1cc(F)c2cc[nH]c2[nH]1.
What is the InChIKey of 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one?
The InChIKey is VXEXHLJTFTXCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O/c8-5-3-6(11)10-7-4(5)1-2-9-7/h1-3H,(H2,9,10,11).
What are the key properties of 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one?
4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one has a molecular weight of 152.13 g/mol, XLogP of 1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,7-dihydropyrrolo[2,3-b]pyridin-6-one is sourced from PubChem (CID 53412864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).