About 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde
1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde (PubChem CID 53413137) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde |
| PubChem CID | 53413137 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde |
| SMILES | O=Cc1ccnc2[nH]cc(C=O)c12 |
| InChI | InChI=1S/C9H6N2O2/c12-4-6-1-2-10-9-8(6)7(5-13)3-11-9/h1-5H,(H,10,11) |
| InChIKey | JSVQERJAFBDBHS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde?
The IUPAC name of 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde (CID 53413137) is 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde.
What is the SMILES notation for 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde?
The canonical SMILES for 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde is O=Cc1ccnc2[nH]cc(C=O)c12.
What is the InChIKey of 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde?
The InChIKey is JSVQERJAFBDBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-4-6-1-2-10-9-8(6)7(5-13)3-11-9/h1-5H,(H,10,11).
What are the key properties of 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde?
1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde has a molecular weight of 174.16 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-b]pyridine-3,4-dicarbaldehyde is sourced from PubChem (CID 53413137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).