C12H17N2OS3+ — CID 53413494
5-(3-ethyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-1-ylidene)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 53413494) has the molecular formula C12H17N2OS3+ and a molecular weight of 301.48 g/mol. Its IUPAC name is 5-(3-ethyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-1-ylidene)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-1-ylidene)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 53413494 |
| Molecular Formula | C12H17N2OS3+ |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-(3-ethyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-1-ylidene)-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=S2C=[N+](CC)C(C)C2)SC1=S |
| InChI | InChI=1S/C12H17N2OS3/c1-4-6-14-10(15)11(17-12(14)16)18-7-9(3)13(5-2)8-18/h4,8-9H,1,5-7H2,2-3H3/q+1 |
| InChIKey | NBRPMKPNXVLPQU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|