About 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile
2-(4-amino-1,3,5-triazin-2-yl)acetonitrile (PubChem CID 53416270) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile |
| PubChem CID | 53416270 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile |
| SMILES | N#CCc1ncnc(N)n1 |
| InChI | InChI=1S/C5H5N5/c6-2-1-4-8-3-9-5(7)10-4/h3H,1H2,(H2,7,8,9,10) |
| InChIKey | RNJZTQPJTWQOLQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile?
The IUPAC name of 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile (CID 53416270) is 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile.
What is the SMILES notation for 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile?
The canonical SMILES for 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile is N#CCc1ncnc(N)n1.
What is the InChIKey of 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile?
The InChIKey is RNJZTQPJTWQOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c6-2-1-4-8-3-9-5(7)10-4/h3H,1H2,(H2,7,8,9,10).
What are the key properties of 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile?
2-(4-amino-1,3,5-triazin-2-yl)acetonitrile has a molecular weight of 135.13 g/mol, XLogP of -0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-1,3,5-triazin-2-yl)acetonitrile is sourced from PubChem (CID 53416270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).