C6HF9 — CID 534168
1,3,3,4,4,5,5,6,6-nonafluorocyclohexene (PubChem CID 534168) has the molecular formula C6HF9 and a molecular weight of 244.06 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluorocyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
|---|---|
| PubChem CID | 534168 |
| Molecular Formula | C6HF9 |
| Molecular Weight | 244.06 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
| SMILES | FC1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HF9/c7-2-1-3(8,9)5(12,13)6(14,15)4(2,10)11/h1H |
| InChIKey | MLVFVGWXXSLCMI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.06 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|