About 4,5-dibromo-2-fluorophenol
4,5-dibromo-2-fluorophenol (PubChem CID 53417592) has the molecular formula C6H3Br2FO
and a molecular weight of 269.89 g/mol. Its IUPAC name is 4,5-dibromo-2-fluorophenol.
Molecular Properties
| Compound Name | 4,5-dibromo-2-fluorophenol |
| PubChem CID | 53417592 |
| Molecular Formula | C6H3Br2FO |
| Molecular Weight | 269.89 g/mol |
| Exact Mass | 267.85 |
| IUPAC Name | 4,5-dibromo-2-fluorophenol |
| SMILES | Oc1cc(Br)c(Br)cc1F |
| InChI | InChI=1S/C6H3Br2FO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
| InChIKey | ICSZBSDJUJFNOG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dibromo-2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-2-fluorophenol?
The IUPAC name of 4,5-dibromo-2-fluorophenol (CID 53417592) is 4,5-dibromo-2-fluorophenol.
What is the SMILES notation for 4,5-dibromo-2-fluorophenol?
The canonical SMILES for 4,5-dibromo-2-fluorophenol is Oc1cc(Br)c(Br)cc1F.
What is the InChIKey of 4,5-dibromo-2-fluorophenol?
The InChIKey is ICSZBSDJUJFNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2FO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H.
What are the key properties of 4,5-dibromo-2-fluorophenol?
4,5-dibromo-2-fluorophenol has a molecular weight of 269.89 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-2-fluorophenol is sourced from PubChem (CID 53417592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).