About 4-(2-bromoethyl)-2,6-dimethylmorpholine
4-(2-bromoethyl)-2,6-dimethylmorpholine (PubChem CID 53417644) has the molecular formula C8H16BrNO
and a molecular weight of 222.13 g/mol. Its IUPAC name is 4-(2-bromoethyl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(2-bromoethyl)-2,6-dimethylmorpholine |
| PubChem CID | 53417644 |
| Molecular Formula | C8H16BrNO |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 4-(2-bromoethyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(CCBr)CC(C)O1 |
| InChI | InChI=1S/C8H16BrNO/c1-7-5-10(4-3-9)6-8(2)11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FZUMZQZVVFIUOM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethyl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethyl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(2-bromoethyl)-2,6-dimethylmorpholine (CID 53417644) is 4-(2-bromoethyl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(2-bromoethyl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(2-bromoethyl)-2,6-dimethylmorpholine is CC1CN(CCBr)CC(C)O1.
What is the InChIKey of 4-(2-bromoethyl)-2,6-dimethylmorpholine?
The InChIKey is FZUMZQZVVFIUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BrNO/c1-7-5-10(4-3-9)6-8(2)11-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 4-(2-bromoethyl)-2,6-dimethylmorpholine?
4-(2-bromoethyl)-2,6-dimethylmorpholine has a molecular weight of 222.13 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethyl)-2,6-dimethylmorpholine is sourced from PubChem (CID 53417644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).