About 4-(difluoromethoxy)-2,6-difluorobenzonitrile
4-(difluoromethoxy)-2,6-difluorobenzonitrile (PubChem CID 53417928) has the molecular formula C8H3F4NO
and a molecular weight of 205.11 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-2,6-difluorobenzonitrile |
| PubChem CID | 53417928 |
| Molecular Formula | C8H3F4NO |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 4-(difluoromethoxy)-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(OC(F)F)cc1F |
| InChI | InChI=1S/C8H3F4NO/c9-6-1-4(14-8(11)12)2-7(10)5(6)3-13/h1-2,8H |
| InChIKey | UKUBMSGIMQDVNC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(difluoromethoxy)-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-2,6-difluorobenzonitrile?
The IUPAC name of 4-(difluoromethoxy)-2,6-difluorobenzonitrile (CID 53417928) is 4-(difluoromethoxy)-2,6-difluorobenzonitrile.
What is the SMILES notation for 4-(difluoromethoxy)-2,6-difluorobenzonitrile?
The canonical SMILES for 4-(difluoromethoxy)-2,6-difluorobenzonitrile is N#Cc1c(F)cc(OC(F)F)cc1F.
What is the InChIKey of 4-(difluoromethoxy)-2,6-difluorobenzonitrile?
The InChIKey is UKUBMSGIMQDVNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F4NO/c9-6-1-4(14-8(11)12)2-7(10)5(6)3-13/h1-2,8H.
What are the key properties of 4-(difluoromethoxy)-2,6-difluorobenzonitrile?
4-(difluoromethoxy)-2,6-difluorobenzonitrile has a molecular weight of 205.11 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-2,6-difluorobenzonitrile is sourced from PubChem (CID 53417928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).