C9H13N3 — CID 53418196
5,6,7,8-tetrahydroquinolin-5-ylhydrazine (PubChem CID 53418196) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-5-ylhydrazine.
| Compound Name | 5,6,7,8-tetrahydroquinolin-5-ylhydrazine |
|---|---|
| PubChem CID | 53418196 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-5-ylhydrazine |
| SMILES | NNC1CCCc2ncccc21 |
| InChI | InChI=1S/C9H13N3/c10-12-9-5-1-4-8-7(9)3-2-6-11-8/h2-3,6,9,12H,1,4-5,10H2 |
| InChIKey | BOONFLXOAARKKJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|