About tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane
tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane (PubChem CID 53418317) has the molecular formula C16H28F3NOSn
and a molecular weight of 426.11 g/mol. Its IUPAC name is tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane |
| PubChem CID | 53418317 |
| Molecular Formula | C16H28F3NOSn |
| Molecular Weight | 426.11 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C4HF3NO.3C4H9.Sn/c5-4(6,7)3-1-2-9-8-3;3*1-3-4-2;/h1H;3*1,3-4H2,2H3; |
| InChIKey | VHSKKZIBWCWIOO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.11 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane?
The IUPAC name of tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane (CID 53418317) is tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane.
What is the SMILES notation for tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane?
The canonical SMILES for tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane is CCCC[Sn](CCCC)(CCCC)c1cc(C(F)(F)F)no1.
What is the InChIKey of tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane?
The InChIKey is VHSKKZIBWCWIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF3NO.3C4H9.Sn/c5-4(6,7)3-1-2-9-8-3;3*1-3-4-2;/h1H;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane?
tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane has a molecular weight of 426.11 g/mol, XLogP of 5.75, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[3-(trifluoromethyl)-1,2-oxazol-5-yl]stannane is sourced from PubChem (CID 53418317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).