About ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate
ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate (PubChem CID 53418332) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate.
Analyze ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate?
The IUPAC name of ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate (CID 53418332) is ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate.
What is the SMILES notation for ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate?
The canonical SMILES for ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate is CCOC(=O)c1ncn(CC(F)(F)F)c1N.
What is the InChIKey of ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate?
The InChIKey is MTGXAJLRGLOVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-2-16-7(15)5-6(12)14(4-13-5)3-8(9,10)11/h4H,2-3,12H2,1H3.
What are the key properties of ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate?
ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate has a molecular weight of 237.18 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-1-(2,2,2-trifluoroethyl)imidazole-4-carboxylate is sourced from PubChem (CID 53418332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).