About 6-bromo-2,2,4,7-tetramethyl-1H-quinoline
6-bromo-2,2,4,7-tetramethyl-1H-quinoline (PubChem CID 53418602) has the molecular formula C13H16BrN
and a molecular weight of 266.18 g/mol. Its IUPAC name is 6-bromo-2,2,4,7-tetramethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-bromo-2,2,4,7-tetramethyl-1H-quinoline |
| PubChem CID | 53418602 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-bromo-2,2,4,7-tetramethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2cc(C)c(Br)cc21 |
| InChI | InChI=1S/C13H16BrN/c1-8-5-12-10(6-11(8)14)9(2)7-13(3,4)15-12/h5-7,15H,1-4H3 |
| InChIKey | XOXBDHLJZASORX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2,2,4,7-tetramethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,2,4,7-tetramethyl-1H-quinoline?
The IUPAC name of 6-bromo-2,2,4,7-tetramethyl-1H-quinoline (CID 53418602) is 6-bromo-2,2,4,7-tetramethyl-1H-quinoline.
What is the SMILES notation for 6-bromo-2,2,4,7-tetramethyl-1H-quinoline?
The canonical SMILES for 6-bromo-2,2,4,7-tetramethyl-1H-quinoline is CC1=CC(C)(C)Nc2cc(C)c(Br)cc21.
What is the InChIKey of 6-bromo-2,2,4,7-tetramethyl-1H-quinoline?
The InChIKey is XOXBDHLJZASORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN/c1-8-5-12-10(6-11(8)14)9(2)7-13(3,4)15-12/h5-7,15H,1-4H3.
What are the key properties of 6-bromo-2,2,4,7-tetramethyl-1H-quinoline?
6-bromo-2,2,4,7-tetramethyl-1H-quinoline has a molecular weight of 266.18 g/mol, XLogP of 4.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,2,4,7-tetramethyl-1H-quinoline is sourced from PubChem (CID 53418602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).