About 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline
6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 53418628) has the molecular formula C9H9ClFN
and a molecular weight of 185.63 g/mol. Its IUPAC name is 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 53418628 |
| Molecular Formula | C9H9ClFN |
| Molecular Weight | 185.63 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1c(Cl)ccc2c1CCNC2 |
| InChI | InChI=1S/C9H9ClFN/c10-8-2-1-6-5-12-4-3-7(6)9(8)11/h1-2,12H,3-5H2 |
| InChIKey | QJPSJQNDPZAPSO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline (CID 53418628) is 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline is Fc1c(Cl)ccc2c1CCNC2.
What is the InChIKey of 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is QJPSJQNDPZAPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClFN/c10-8-2-1-6-5-12-4-3-7(6)9(8)11/h1-2,12H,3-5H2.
What are the key properties of 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline?
6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 185.63 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-fluoro-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 53418628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).