About prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate
prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 534193) has the molecular formula C12H12F3N3O2
and a molecular weight of 287.24 g/mol. Its IUPAC name is prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| PubChem CID | 534193 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C#CCOC(=O)Nc1cnc(N(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3O2/c1-4-5-20-11(19)17-8-6-9(12(13,14)15)10(16-7-8)18(2)3/h1,6-7H,5H2,2-3H3,(H,17,19) |
| InChIKey | KWLSAQAXNCXSEB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate?
The IUPAC name of prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate (CID 534193) is prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate.
What is the SMILES notation for prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate?
The canonical SMILES for prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate is C#CCOC(=O)Nc1cnc(N(C)C)c(C(F)(F)F)c1.
What is the InChIKey of prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate?
The InChIKey is KWLSAQAXNCXSEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3O2/c1-4-5-20-11(19)17-8-6-9(12(13,14)15)10(16-7-8)18(2)3/h1,6-7H,5H2,2-3H3,(H,17,19).
What are the key properties of prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate?
prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate has a molecular weight of 287.24 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl N-[6-(dimethylamino)-5-(trifluoromethyl)-3-pyridinyl]carbamate is sourced from PubChem (CID 534193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).