About ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate
ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate (PubChem CID 53419352) has the molecular formula C12H10F6O2
and a molecular weight of 300.20 g/mol. Its IUPAC name is ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate |
| PubChem CID | 53419352 |
| Molecular Formula | C12H10F6O2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10F6O2/c1-2-20-10(19)5-7-3-4-8(11(13,14)15)6-9(7)12(16,17)18/h3-4,6H,2,5H2,1H3 |
| InChIKey | HLBAPVRZTPSYLL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate?
The IUPAC name of ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate (CID 53419352) is ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate.
What is the SMILES notation for ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate?
The canonical SMILES for ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate is CCOC(=O)Cc1ccc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate?
The InChIKey is HLBAPVRZTPSYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F6O2/c1-2-20-10(19)5-7-3-4-8(11(13,14)15)6-9(7)12(16,17)18/h3-4,6H,2,5H2,1H3.
What are the key properties of ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate?
ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate has a molecular weight of 300.20 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,4-bis(trifluoromethyl)phenyl]acetate is sourced from PubChem (CID 53419352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).