C13H13NO5 — CID 53419693
methyl 6,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylate (PubChem CID 53419693) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl 6,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | methyl 6,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 53419693 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl 6,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c2cc(OC)cc(OC)c2[nH]1 |
| InChI | InChI=1S/C13H13NO5/c1-17-7-4-8-10(15)6-9(13(16)19-3)14-12(8)11(5-7)18-2/h4-6H,1-3H3,(H,14,15) |
| InChIKey | BJHAJRICDYDEQT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |