C14H12BrF2N — CID 53419869
N-[(4-bromo-2,5-difluorophenyl)methyl]-1-phenylmethanamine (PubChem CID 53419869) has the molecular formula C14H12BrF2N and a molecular weight of 312.16 g/mol. Its IUPAC name is N-[(4-bromo-2,5-difluorophenyl)methyl]-1-phenylmethanamine.
| Compound Name | N-[(4-bromo-2,5-difluorophenyl)methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 53419869 |
| Molecular Formula | C14H12BrF2N |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-[(4-bromo-2,5-difluorophenyl)methyl]-1-phenylmethanamine |
| SMILES | Fc1cc(CNCc2ccccc2)c(F)cc1Br |
| InChI | InChI=1S/C14H12BrF2N/c15-12-7-13(16)11(6-14(12)17)9-18-8-10-4-2-1-3-5-10/h1-7,18H,8-9H2 |
| InChIKey | CKWGURFSYYUZLG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|