1,2,3-benzothiadiazole-4-carbonyl chloride

C7H3ClN2OS — CID 53420084

IUPAC1,2,3-benzothiadiazole-4-carbonyl chloride
SMILESO=C(Cl)c1cccc2snnc12
InChIInChI=1S/C7H3ClN2OS/c8-7(11)4-2-1-3-5-6(4)9-10-12-5/h1-3H
InChIKeyIQMTXLRJSYOVGW-UHFFFAOYSA-N
MW198.63 g/mol
LogP2.07
Rot. Bonds1

About 1,2,3-benzothiadiazole-4-carbonyl chloride

1,2,3-benzothiadiazole-4-carbonyl chloride (PubChem CID 53420084) has the molecular formula C7H3ClN2OS and a molecular weight of 198.63 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-4-carbonyl chloride.

Molecular Properties

Compound Name1,2,3-benzothiadiazole-4-carbonyl chloride
PubChem CID53420084
Molecular FormulaC7H3ClN2OS
Molecular Weight198.63 g/mol
Exact Mass197.97
IUPAC Name1,2,3-benzothiadiazole-4-carbonyl chloride
SMILESO=C(Cl)c1cccc2snnc12
InChIInChI=1S/C7H3ClN2OS/c8-7(11)4-2-1-3-5-6(4)9-10-12-5/h1-3H
InChIKeyIQMTXLRJSYOVGW-UHFFFAOYSA-N
XLogP2.07
TPSA42.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.63
LogP ≤ 52.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,2,3-benzothiadiazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,3-benzothiadiazole-4-carbonyl chloride?
The IUPAC name of 1,2,3-benzothiadiazole-4-carbonyl chloride (CID 53420084) is 1,2,3-benzothiadiazole-4-carbonyl chloride.
What is the SMILES notation for 1,2,3-benzothiadiazole-4-carbonyl chloride?
The canonical SMILES for 1,2,3-benzothiadiazole-4-carbonyl chloride is O=C(Cl)c1cccc2snnc12.
What is the InChIKey of 1,2,3-benzothiadiazole-4-carbonyl chloride?
The InChIKey is IQMTXLRJSYOVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2OS/c8-7(11)4-2-1-3-5-6(4)9-10-12-5/h1-3H.
What are the key properties of 1,2,3-benzothiadiazole-4-carbonyl chloride?
1,2,3-benzothiadiazole-4-carbonyl chloride has a molecular weight of 198.63 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzothiadiazole-4-carbonyl chloride is sourced from PubChem (CID 53420084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).