About 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol
3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (PubChem CID 53420238) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
Molecular Properties
| Compound Name | 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| PubChem CID | 53420238 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| SMILES | CC1(C)C2CC(N)C(C)(O)C1C2 |
| InChI | InChI=1S/C10H19NO/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-8,12H,4-5,11H2,1-3H3 |
| InChIKey | LGVDAZQPWJBBGX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The IUPAC name of 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (CID 53420238) is 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
What is the SMILES notation for 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The canonical SMILES for 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol is CC1(C)C2CC(N)C(C)(O)C1C2.
What is the InChIKey of 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
The InChIKey is LGVDAZQPWJBBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-8,12H,4-5,11H2,1-3H3.
What are the key properties of 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol?
3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol has a molecular weight of 169.27 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol is sourced from PubChem (CID 53420238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).