C14H16Cl2F2N2 — CID 53420253
1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 53420253) has the molecular formula C14H16Cl2F2N2 and a molecular weight of 321.20 g/mol. Its IUPAC name is 1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | 1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 53420253 |
| Molecular Formula | C14H16Cl2F2N2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC(c1ccc(F)cc1)C(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14F2N2.2ClH/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;;/h1-8,13-14H,17-18H2;2*1H |
| InChIKey | ILMQMKZMXREKBI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |