About 3,4-dibromo-5-iodopyridine
3,4-dibromo-5-iodopyridine (PubChem CID 53420269) has the molecular formula C5H2Br2IN
and a molecular weight of 362.79 g/mol. Its IUPAC name is 3,4-dibromo-5-iodopyridine.
Molecular Properties
| Compound Name | 3,4-dibromo-5-iodopyridine |
| PubChem CID | 53420269 |
| Molecular Formula | C5H2Br2IN |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 360.76 |
| IUPAC Name | 3,4-dibromo-5-iodopyridine |
| SMILES | Brc1cncc(I)c1Br |
| InChI | InChI=1S/C5H2Br2IN/c6-3-1-9-2-4(8)5(3)7/h1-2H |
| InChIKey | RCCZPOZNHAIHJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-5-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-5-iodopyridine?
The IUPAC name of 3,4-dibromo-5-iodopyridine (CID 53420269) is 3,4-dibromo-5-iodopyridine.
What is the SMILES notation for 3,4-dibromo-5-iodopyridine?
The canonical SMILES for 3,4-dibromo-5-iodopyridine is Brc1cncc(I)c1Br.
What is the InChIKey of 3,4-dibromo-5-iodopyridine?
The InChIKey is RCCZPOZNHAIHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Br2IN/c6-3-1-9-2-4(8)5(3)7/h1-2H.
What are the key properties of 3,4-dibromo-5-iodopyridine?
3,4-dibromo-5-iodopyridine has a molecular weight of 362.79 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-5-iodopyridine is sourced from PubChem (CID 53420269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).