About 1-cyclohexyl-3,4-difluoropyrrolidine
1-cyclohexyl-3,4-difluoropyrrolidine (PubChem CID 53420720) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-cyclohexyl-3,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,4-difluoropyrrolidine |
| PubChem CID | 53420720 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-cyclohexyl-3,4-difluoropyrrolidine |
| SMILES | FC1CN(C2CCCCC2)CC1F |
| InChI | InChI=1S/C10H17F2N/c11-9-6-13(7-10(9)12)8-4-2-1-3-5-8/h8-10H,1-7H2 |
| InChIKey | DSKZPSBKPCMZJX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,4-difluoropyrrolidine?
The IUPAC name of 1-cyclohexyl-3,4-difluoropyrrolidine (CID 53420720) is 1-cyclohexyl-3,4-difluoropyrrolidine.
What is the SMILES notation for 1-cyclohexyl-3,4-difluoropyrrolidine?
The canonical SMILES for 1-cyclohexyl-3,4-difluoropyrrolidine is FC1CN(C2CCCCC2)CC1F.
What is the InChIKey of 1-cyclohexyl-3,4-difluoropyrrolidine?
The InChIKey is DSKZPSBKPCMZJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N/c11-9-6-13(7-10(9)12)8-4-2-1-3-5-8/h8-10H,1-7H2.
What are the key properties of 1-cyclohexyl-3,4-difluoropyrrolidine?
1-cyclohexyl-3,4-difluoropyrrolidine has a molecular weight of 189.25 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,4-difluoropyrrolidine is sourced from PubChem (CID 53420720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).