About 4-aminopyridine-3,5-diol
4-aminopyridine-3,5-diol (PubChem CID 53421074) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 4-aminopyridine-3,5-diol.
Molecular Properties
| Compound Name | 4-aminopyridine-3,5-diol |
| PubChem CID | 53421074 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 4-aminopyridine-3,5-diol |
| SMILES | Nc1c(O)cncc1O |
| InChI | InChI=1S/C5H6N2O2/c6-5-3(8)1-7-2-4(5)9/h1-2,8-9H,(H2,6,7) |
| InChIKey | WTPNTRKKYPZUNJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-aminopyridine-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyridine-3,5-diol?
The IUPAC name of 4-aminopyridine-3,5-diol (CID 53421074) is 4-aminopyridine-3,5-diol.
What is the SMILES notation for 4-aminopyridine-3,5-diol?
The canonical SMILES for 4-aminopyridine-3,5-diol is Nc1c(O)cncc1O.
What is the InChIKey of 4-aminopyridine-3,5-diol?
The InChIKey is WTPNTRKKYPZUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c6-5-3(8)1-7-2-4(5)9/h1-2,8-9H,(H2,6,7).
What are the key properties of 4-aminopyridine-3,5-diol?
4-aminopyridine-3,5-diol has a molecular weight of 126.11 g/mol, XLogP of 0.08, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyridine-3,5-diol is sourced from PubChem (CID 53421074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).