About cyclohepta-1,3,6-triene-1-carboxamide
cyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 53421645) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is cyclohepta-1,3,6-triene-1-carboxamide.
Molecular Properties
| Compound Name | cyclohepta-1,3,6-triene-1-carboxamide |
| PubChem CID | 53421645 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | cyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | NC(=O)C1=CC=CCC=C1 |
| InChI | InChI=1S/C8H9NO/c9-8(10)7-5-3-1-2-4-6-7/h1,3-6H,2H2,(H2,9,10) |
| InChIKey | AMNLJVFQVRBZLN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta-1,3,6-triene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,3,6-triene-1-carboxamide?
The IUPAC name of cyclohepta-1,3,6-triene-1-carboxamide (CID 53421645) is cyclohepta-1,3,6-triene-1-carboxamide.
What is the SMILES notation for cyclohepta-1,3,6-triene-1-carboxamide?
The canonical SMILES for cyclohepta-1,3,6-triene-1-carboxamide is NC(=O)C1=CC=CCC=C1.
What is the InChIKey of cyclohepta-1,3,6-triene-1-carboxamide?
The InChIKey is AMNLJVFQVRBZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c9-8(10)7-5-3-1-2-4-6-7/h1,3-6H,2H2,(H2,9,10).
What are the key properties of cyclohepta-1,3,6-triene-1-carboxamide?
cyclohepta-1,3,6-triene-1-carboxamide has a molecular weight of 135.17 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,3,6-triene-1-carboxamide is sourced from PubChem (CID 53421645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).