About ethane-1,1,2-tricarbonitrile
ethane-1,1,2-tricarbonitrile (PubChem CID 534221) has the molecular formula C5H3N3
and a molecular weight of 105.10 g/mol. Its IUPAC name is ethane-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | ethane-1,1,2-tricarbonitrile |
| PubChem CID | 534221 |
| Molecular Formula | C5H3N3 |
| Molecular Weight | 105.10 g/mol |
| Exact Mass | 105.03 |
| IUPAC Name | ethane-1,1,2-tricarbonitrile |
| SMILES | N#CCC(C#N)C#N |
| InChI | InChI=1S/C5H3N3/c6-2-1-5(3-7)4-8/h5H,1H2 |
| InChIKey | DXBLIMATEQZDKB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.10 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1,2-tricarbonitrile?
The IUPAC name of ethane-1,1,2-tricarbonitrile (CID 534221) is ethane-1,1,2-tricarbonitrile.
What is the SMILES notation for ethane-1,1,2-tricarbonitrile?
The canonical SMILES for ethane-1,1,2-tricarbonitrile is N#CCC(C#N)C#N.
What is the InChIKey of ethane-1,1,2-tricarbonitrile?
The InChIKey is DXBLIMATEQZDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3/c6-2-1-5(3-7)4-8/h5H,1H2.
What are the key properties of ethane-1,1,2-tricarbonitrile?
ethane-1,1,2-tricarbonitrile has a molecular weight of 105.10 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1,2-tricarbonitrile is sourced from PubChem (CID 534221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).