About 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride
1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride (PubChem CID 53422269) has the molecular formula C18H28ClNO2
and a molecular weight of 325.88 g/mol. Its IUPAC name is 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride |
| PubChem CID | 53422269 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride |
| SMILES | CC(C)c1ccc(C(C)C)c(C(=O)CN2CCOCC2)c1.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-13(2)15-5-6-16(14(3)4)17(11-15)18(20)12-19-7-9-21-10-8-19;/h5-6,11,13-14H,7-10,12H2,1-4H3;1H |
| InChIKey | VKACNHCUVSHURF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride?
The IUPAC name of 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride (CID 53422269) is 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride.
What is the SMILES notation for 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride?
The canonical SMILES for 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride is CC(C)c1ccc(C(C)C)c(C(=O)CN2CCOCC2)c1.Cl.
What is the InChIKey of 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride?
The InChIKey is VKACNHCUVSHURF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2.ClH/c1-13(2)15-5-6-16(14(3)4)17(11-15)18(20)12-19-7-9-21-10-8-19;/h5-6,11,13-14H,7-10,12H2,1-4H3;1H.
What are the key properties of 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride?
1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride has a molecular weight of 325.88 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,5-di(propan-2-yl)phenyl]-2-morpholin-4-ylethanone;hydrochloride is sourced from PubChem (CID 53422269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).