C8H9N3O6 — CID 53422859
5,6-dimethyl-1,3,5-trinitrocyclohexa-1,3-diene (PubChem CID 53422859) has the molecular formula C8H9N3O6 and a molecular weight of 243.18 g/mol. Its IUPAC name is 5,6-dimethyl-1,3,5-trinitrocyclohexa-1,3-diene.
| Compound Name | 5,6-dimethyl-1,3,5-trinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 53422859 |
| Molecular Formula | C8H9N3O6 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5,6-dimethyl-1,3,5-trinitrocyclohexa-1,3-diene |
| SMILES | CC1C([N+](=O)[O-])=CC([N+](=O)[O-])=CC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N3O6/c1-5-7(10(14)15)3-6(9(12)13)4-8(5,2)11(16)17/h3-5H,1-2H3 |
| InChIKey | XYYWTOMODHYSRH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|